CAS 2925480-26-6 is the registry number for (E)-3-(5-Fluoro-2,6-dimethylpyrimidin-4-yl)acrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(5-fluoro-2,6-dimethylpyrimidin-4-yl)prop-2-enoic acid (CAS 2925480-26-6) is a chemical compound with the molecular formula C9H9FN2O2 and a molecular weight of 196.18 g/mol. IUPAC name: (E)-3-(5-fluoro-2,6-dimethylpyrimidin-4-yl)prop-2-enoic acid. InChIKey: HRZNSCIWTQXHSK-ONEGZZNKSA-N.
| Molecular formula | C9H9FN2O2 |
|---|---|
| Molecular weight | 196.18 g/mol |
| IUPAC name | (E)-3-(5-fluoro-2,6-dimethylpyrimidin-4-yl)prop-2-enoic acid |
| InChIKey | HRZNSCIWTQXHSK-ONEGZZNKSA-N |
| SMILES | CC1=C(C(=NC(=N1)C)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)