CAS 2810030-12-5 is the registry number for 3-Fluoro-5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-fluoro-5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxylic acid (CAS 2810030-12-5) is a chemical compound with the molecular formula C9H9FN2O2 and a molecular weight of 196.18 g/mol. IUPAC name: 3-fluoro-5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxylic acid. InChIKey: BOBMKZRITBCUNM-UHFFFAOYSA-N.
| Molecular formula | C9H9FN2O2 |
|---|---|
| Molecular weight | 196.18 g/mol |
| IUPAC name | 3-fluoro-5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxylic acid |
| InChIKey | BOBMKZRITBCUNM-UHFFFAOYSA-N |
| SMILES | C1CNCC2=CC(=C(N=C21)C(=O)O)F |
Computed by PubChem (NCBI)