cas: 425654-95-1 — see every product listed under this CAS number, including other names
N-Cyclopropyl-4-fluorobenzenesulfonamide 98% (CAS 425654-95-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A361746-250mg |
| cas | 425654-95-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 281.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A361746 |
N-cyclopropyl-4-fluorobenzenesulfonamide (CAS 425654-95-1) is a chemical compound with the molecular formula C9H10FNO2S and a molecular weight of 215.25 g/mol. IUPAC name: N-cyclopropyl-4-fluorobenzenesulfonamide. InChIKey: QXHJRYPFPZGNNV-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2S |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | N-cyclopropyl-4-fluorobenzenesulfonamide |
| InChIKey | QXHJRYPFPZGNNV-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)