CAS 1225954-22-2 is the registry number for N-(3-Fluorophenyl)-1,3-propanesultam, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.
2-(3-fluorophenyl)-1,2-thiazolidine 1,1-dioxide (CAS 1225954-22-2) is a chemical compound with the molecular formula C9H10FNO2S and a molecular weight of 215.25 g/mol. IUPAC name: 2-(3-fluorophenyl)-1,2-thiazolidine 1,1-dioxide. InChIKey: MHUZNNUKOGJZKU-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2S |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-1,2-thiazolidine 1,1-dioxide |
| InChIKey | MHUZNNUKOGJZKU-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)