CAS 1782890-59-8 is the registry number for 3-((3-Fluorophenyl)amino)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-fluorophenyl)-1,1-dioxothietan-3-amine (CAS 1782890-59-8) is a chemical compound with the molecular formula C9H10FNO2S and a molecular weight of 215.25 g/mol. IUPAC name: N-(3-fluorophenyl)-1,1-dioxothietan-3-amine. InChIKey: NCXGJKIZDRRYFV-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2S |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | N-(3-fluorophenyl)-1,1-dioxothietan-3-amine |
| InChIKey | NCXGJKIZDRRYFV-UHFFFAOYSA-N |
| SMILES | C1C(CS1(=O)=O)NC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)