Products 1226211-16-0

CAS 1226211-16-0 is the registry number for N-(2-Fluorophenyl)-1,3-propanesultam, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2-fluorophenyl)-1,2-thiazolidine 1,1-dioxide (CAS 1226211-16-0) is a chemical compound with the molecular formula C9H10FNO2S and a molecular weight of 215.25 g/mol. IUPAC name: 2-(2-fluorophenyl)-1,2-thiazolidine 1,1-dioxide. InChIKey: JDIJXTANDAIYBV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10FNO2S
Molecular weight215.25 g/mol
IUPAC name2-(2-fluorophenyl)-1,2-thiazolidine 1,1-dioxide
InChIKeyJDIJXTANDAIYBV-UHFFFAOYSA-N
SMILESC1CN(S(=O)(=O)C1)C2=CC=CC=C2F

Computed by PubChem (NCBI)