CAS 2093788-64-6 is the registry number for 4-Fluoro-1-methanesulfonyl-2,3-dihydroindole, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-fluoro-1-methylsulfonyl-2,3-dihydroindole (CAS 2093788-64-6) is a chemical compound with the molecular formula C9H10FNO2S and a molecular weight of 215.25 g/mol. IUPAC name: 4-fluoro-1-methylsulfonyl-2,3-dihydroindole. InChIKey: MXZGGEKFVGEJPN-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2S |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 4-fluoro-1-methylsulfonyl-2,3-dihydroindole |
| InChIKey | MXZGGEKFVGEJPN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC2=C1C=CC=C2F |
Computed by PubChem (NCBI)