cas: 23530-41-8 — see every product listed under this CAS number, including other names
N-Ethyl-2-nitrobenzenesulfonamide 98% (CAS 23530-41-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A602117-1g |
| cas | 23530-41-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 854.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A602117 |
N-ethyl-2-nitrobenzenesulfonamide (CAS 23530-41-8) is a chemical compound with the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. IUPAC name: N-ethyl-2-nitrobenzenesulfonamide. InChIKey: MQOIFAQSYCSLRF-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | N-ethyl-2-nitrobenzenesulfonamide |
| InChIKey | MQOIFAQSYCSLRF-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)