cas: 57322-50-6 — see every product listed under this CAS number, including other names
N-Ethyl-2-phenyl-N-(pyridin-4-ylmethyl)acrylamide, 90%(GC), 90%(GC) (CAS 57322-50-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114T1J-100mg |
| cas | 57322-50-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 726.80 Pln | |
| Chemat | 50mg | 453.20 Pln | |
| Chemat | 250mg | 1566.80 Pln | |
| Chemat | 1g | 5891.60 Pln |
| purity | 90%(GC) |
|---|---|
| delivery time | 3 weeks |
N-ethyl-2-phenyl-N-(pyridin-4-ylmethyl)prop-2-enamide (CAS 57322-50-6) is a chemical compound with the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. IUPAC name: N-ethyl-2-phenyl-N-(pyridin-4-ylmethyl)prop-2-enamide. InChIKey: LOVSQYAVWGMIRV-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | N-ethyl-2-phenyl-N-(pyridin-4-ylmethyl)prop-2-enamide |
| InChIKey | LOVSQYAVWGMIRV-UHFFFAOYSA-N |
| SMILES | CCN(CC1=CC=NC=C1)C(=O)C(=C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)