Products 1335041-71-8
CAS 1335041-71-8 is the registry number for 3-Amino-3'-(pyrrolidinocarbonyl)biphenyl, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
[3-(3-aminophenyl)phenyl]-pyrrolidin-1-ylmethanone (CAS 1335041-71-8) is a chemical compound with the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. IUPAC name: [3-(3-aminophenyl)phenyl]-pyrrolidin-1-ylmethanone. InChIKey: POEPLCFHMAEHPS-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | [3-(3-aminophenyl)phenyl]-pyrrolidin-1-ylmethanone |
| InChIKey | POEPLCFHMAEHPS-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CC=CC(=C2)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)