CAS 954565-45-8 appears in our catalog under these names: 2-(4-Aminophenyl)-1-(1,2,3,4-tetrahydroquinolin-1-yl)ethan-1-one, 95%, 2-(4-Aminophenyl)-1-(1,2,3,4-tetrahydroquinolin-1-yl)ethan-1-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-(4-aminophenyl)-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone (CAS 954565-45-8) is a chemical compound with the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. IUPAC name: 2-(4-aminophenyl)-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone. InChIKey: RGHPZWWKTGVVPG-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | 2-(4-aminophenyl)-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone |
| InChIKey | RGHPZWWKTGVVPG-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2N(C1)C(=O)CC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)