Products 775302-23-3
CAS 775302-23-3 is the registry number for 2-(4-tert-Butylphenyl)-1,3-benzoxazol-6-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(4-tert-butylphenyl)-1,3-benzoxazol-6-amine (CAS 775302-23-3) is a chemical compound with the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-1,3-benzoxazol-6-amine. InChIKey: FONRONRWLQVFEJ-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-1,3-benzoxazol-6-amine |
| InChIKey | FONRONRWLQVFEJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NC3=C(O2)C=C(C=C3)N |
Computed by PubChem (NCBI)