Products 1449688-89-4
CAS 1449688-89-4 is the registry number for (S,E)-2-Amino-3-phenyl-n-styrylpropanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S)-2-amino-3-phenyl-N-[(E)-2-phenylethenyl]propanamide (CAS 1449688-89-4) is a chemical compound with the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. IUPAC name: (2S)-2-amino-3-phenyl-N-[(E)-2-phenylethenyl]propanamide. InChIKey: XELOBUFGOXPRGZ-PCUGXKRQSA-N.
| Molecular formula | C17H18N2O |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | (2S)-2-amino-3-phenyl-N-[(E)-2-phenylethenyl]propanamide |
| InChIKey | XELOBUFGOXPRGZ-PCUGXKRQSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N/C=C/C2=CC=CC=C2)N |
Computed by PubChem (NCBI)