cas: 672310-11-1 — see every product listed under this CAS number, including other names
N-Fmoc-3-piperidinone 97% (CAS 672310-11-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A957051-250mg |
| cas | 672310-11-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 431.56 Pln | |
| Ambeed | 5g | 1349.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A957051 |
9H-fluoren-9-ylmethyl 3-oxopiperidine-1-carboxylate (CAS 672310-11-1) is a chemical compound with the molecular formula C20H19NO3 and a molecular weight of 321.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl 3-oxopiperidine-1-carboxylate. InChIKey: ZHMRQZFSADRNCI-UHFFFAOYSA-N.
| Molecular formula | C20H19NO3 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl 3-oxopiperidine-1-carboxylate |
| InChIKey | ZHMRQZFSADRNCI-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CN(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)