CAS 207291-76-7 appears in our catalog under these names: N–Fmoc–L–alanine monohydrate, N-Fmoc-L-alanine monohydrate, 98% , Fmoc-L-Ala-OH monohydrate, Fmoc-Ala-OH.H2O 98%, FMoc-ala-oh h2o, 95%, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1000g, 100g, 500g, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;hydrate (CAS 207291-76-7) is a chemical compound with the molecular formula C18H19NO5 and a molecular weight of 329.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;hydrate. InChIKey: GAPWKFLOMOFHGO-MERQFXBCSA-N.
| Molecular formula | C18H19NO5 |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;hydrate |
| InChIKey | GAPWKFLOMOFHGO-MERQFXBCSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13.O |
Computed by PubChem (NCBI)