CAS 124456-04-8 appears in our catalog under these names: Z-D-Tyrosine methyl ester, 95%, (R)–Methyl 2–(((benzyloxy)carbonyl)amino)–3–(4–hydroxyphenyl)propanoate, Z-D-Tyr-OMe 98%, Z-D-Tyr-OMe, 98%, 98%, (R)-Methyl 2-(((benzyloxy)carbonyl)amino)-3-(4-hydroxyphenyl)propanoate, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100g.
Methyl (2R)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate (CAS 124456-04-8) is a chemical compound with the molecular formula C18H19NO5 and a molecular weight of 329.3 g/mol. IUPAC name: methyl (2R)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: SLLMDHBKALJDBW-MRXNPFEDSA-N.
| Molecular formula | C18H19NO5 |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | methyl (2R)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | SLLMDHBKALJDBW-MRXNPFEDSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)