Products 144710-35-0

CAS 144710-35-0 is the registry number for Ketorolac Impurity 31. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Diethyl 2-(5-benzoyl-1H-pyrrol-2-yl)propanedioate (CAS 144710-35-0) is a chemical compound with the molecular formula C18H19NO5 and a molecular weight of 329.3 g/mol. IUPAC name: diethyl 2-(5-benzoyl-1H-pyrrol-2-yl)propanedioate. InChIKey: GNHABAJJEFVNQW-UHFFFAOYSA-N.

Identity
Molecular formulaC18H19NO5
Molecular weight329.3 g/mol
IUPAC namediethyl 2-(5-benzoyl-1H-pyrrol-2-yl)propanedioate
InChIKeyGNHABAJJEFVNQW-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=CC=C(N1)C(=O)C2=CC=CC=C2)C(=O)OCC

Computed by PubChem (NCBI)