CAS 20806-43-3 appears in our catalog under these names: Z–Ser(Bzl)–OH, Z-L-Ser(Bzl)-OH, Cbz-Ser(bzl)-OH, Cbz-Ser(Bzl)-OH 95%, Z-Ser(Bzl)-OH, 95%, 95%. Offered by: GLPBio, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 10g, 50g, 1g, 500g, 250mg.
(2S)-3-phenylmethoxy-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 20806-43-3) is a chemical compound with the molecular formula C18H19NO5 and a molecular weight of 329.3 g/mol. IUPAC name: (2S)-3-phenylmethoxy-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: CYYRLHUAMWRBHC-INIZCTEOSA-N.
| Molecular formula | C18H19NO5 |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | (2S)-3-phenylmethoxy-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | CYYRLHUAMWRBHC-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)