CAS 201336-54-1 is the registry number for L-beta-Phenyllactoyl-Tyr-OH. Offered by: Creative Peptides. Available pack sizes: 50mg, 250mg.
(2S)-3-(4-hydroxyphenyl)-2-[[(2S)-2-hydroxy-3-phenylpropanoyl]amino]propanoic acid (CAS 201336-54-1) is a chemical compound with the molecular formula C18H19NO5 and a molecular weight of 329.3 g/mol. IUPAC name: (2S)-3-(4-hydroxyphenyl)-2-[[(2S)-2-hydroxy-3-phenylpropanoyl]amino]propanoic acid. InChIKey: AJVFRMRGYXQCPD-HOTGVXAUSA-N.
| Molecular formula | C18H19NO5 |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | (2S)-3-(4-hydroxyphenyl)-2-[[(2S)-2-hydroxy-3-phenylpropanoyl]amino]propanoic acid |
| InChIKey | AJVFRMRGYXQCPD-HOTGVXAUSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)O)O |
Computed by PubChem (NCBI)