CAS 133464-46-7 appears in our catalog under these names: Fmoc–Glu(OAll)–OH, Fmoc-L-Glu(OAll)-OH, N-Fmoc-L-glutamic acid 5-allyl ester, 95% , 5-Allyl N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-glutamate, >96.0%(HPLC)(T), Fmoc-Glu(OAll)-OH, 98.00%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 1000g, 250mg, 10g, 50g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid (CAS 133464-46-7) is a chemical compound with the molecular formula C23H23NO6 and a molecular weight of 409.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid. InChIKey: LRBARFFNYOKIAX-FQEVSTJZSA-N.
| Molecular formula | C23H23NO6 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid |
| InChIKey | LRBARFFNYOKIAX-FQEVSTJZSA-N |
| SMILES | C=CCOC(=O)CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)