cas: 29885-95-8 — see every product listed under this CAS number, including other names
N-METHYLANILINIUM TRIFLUOROACETATE, 98% (CAS 29885-95-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F842789-5G |
| cas | 29885-95-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 25g | 393.63 Pln | |
| Fluorochem | 100g | 1424.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl(phenyl)azanium;2,2,2-trifluoroacetate (CAS 29885-95-8) is a chemical compound with the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. IUPAC name: methyl(phenyl)azanium;2,2,2-trifluoroacetate. InChIKey: TXXJGCVOHDSYBC-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | methyl(phenyl)azanium;2,2,2-trifluoroacetate |
| InChIKey | TXXJGCVOHDSYBC-UHFFFAOYSA-N |
| SMILES | C[NH2+]C1=CC=CC=C1.C(=O)(C(F)(F)F)[O-] |
Computed by PubChem (NCBI)