cas: 29885-95-8 — see every product listed under this CAS number, including other names
N-METHYLANILINIUMTRIFLUOROACETATE, 98%, 98% (CAS 29885-95-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114T85-100mg |
| cas | 29885-95-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 194.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl(phenyl)azanium;2,2,2-trifluoroacetate (CAS 29885-95-8) is a chemical compound with the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. IUPAC name: methyl(phenyl)azanium;2,2,2-trifluoroacetate. InChIKey: TXXJGCVOHDSYBC-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | methyl(phenyl)azanium;2,2,2-trifluoroacetate |
| InChIKey | TXXJGCVOHDSYBC-UHFFFAOYSA-N |
| SMILES | C[NH2+]C1=CC=CC=C1.C(=O)(C(F)(F)F)[O-] |
Computed by PubChem (NCBI)