cas: 197632-83-0 — see every product listed under this CAS number, including other names
N-Me-Ser(Tbu)-OH, 97%, 97% (CAS 197632-83-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113AWW-100mg |
| cas | 197632-83-0 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 486.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(methylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid (CAS 197632-83-0) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: (2S)-2-(methylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid. InChIKey: DLTSMSCPUUWYDX-LURJTMIESA-N.
| Molecular formula | C8H17NO3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | (2S)-2-(methylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| InChIKey | DLTSMSCPUUWYDX-LURJTMIESA-N |
| SMILES | CC(C)(C)OC[C@@H](C(=O)O)NC |
Computed by PubChem (NCBI)