CAS 1704955-68-9 is the registry number for H-D-MeSer(tBu)-OH. Offered by: Iris Biotech. Available pack sizes: 250mg, 500mg, 1g.
(2R)-2-(methylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid (CAS 1704955-68-9) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: (2R)-2-(methylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid. InChIKey: DLTSMSCPUUWYDX-ZCFIWIBFSA-N.
| Molecular formula | C8H17NO3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | (2R)-2-(methylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| InChIKey | DLTSMSCPUUWYDX-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC[C@H](C(=O)O)NC |
Computed by PubChem (NCBI)