cas: 51584-18-0 — see every product listed under this CAS number, including other names
N-Methyl-3-indoleglyoxylic acid, 97%, 97% (CAS 51584-18-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DJ31-100mg |
| cas | 51584-18-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 275.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(1-methylindol-3-yl)-2-oxoacetic acid (CAS 51584-18-0) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 2-(1-methylindol-3-yl)-2-oxoacetic acid. InChIKey: UJQAQVXJQOQUEK-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 2-(1-methylindol-3-yl)-2-oxoacetic acid |
| InChIKey | UJQAQVXJQOQUEK-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C(=O)C(=O)O |
Computed by PubChem (NCBI)