cas: 115994-87-1 — see every product listed under this CAS number, including other names
N-Phenylpiperazine-1-carboxamide, 98%, 98% (CAS 115994-87-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111HE5-1g |
| cas | 115994-87-1 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 846.80 Pln | |
| Chemat | 10g | 1398.80 Pln | |
| Chemat | 25g | 2733.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-phenylpiperazine-1-carboxamide (CAS 115994-87-1) is a chemical compound with the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. IUPAC name: N-phenylpiperazine-1-carboxamide. InChIKey: YEQDVKYOHVLZPU-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O |
|---|---|
| Molecular weight | 205.26 g/mol |
| IUPAC name | N-phenylpiperazine-1-carboxamide |
| InChIKey | YEQDVKYOHVLZPU-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)