cas: 874289-48-2 — see every product listed under this CAS number, including other names
N-Propyl 3-borono-4-fluorobenzamide, 98%, 98% (CAS 874289-48-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115MGX-250mg |
| cas | 874289-48-2 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 626.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[2-fluoro-5-(propylcarbamoyl)phenyl]boronic acid (CAS 874289-48-2) is a chemical compound with the molecular formula C10H13BFNO3 and a molecular weight of 225.03 g/mol. IUPAC name: [2-fluoro-5-(propylcarbamoyl)phenyl]boronic acid. InChIKey: UTFWGDUSGXDUNF-UHFFFAOYSA-N.
| Molecular formula | C10H13BFNO3 |
|---|---|
| Molecular weight | 225.03 g/mol |
| IUPAC name | [2-fluoro-5-(propylcarbamoyl)phenyl]boronic acid |
| InChIKey | UTFWGDUSGXDUNF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)NCCC)F)(O)O |
Computed by PubChem (NCBI)