CAS 1704082-21-2 is the registry number for (3–Fluoro–5–(isopropylcarbamoyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[3-fluoro-5-(propan-2-ylcarbamoyl)phenyl]boronic acid (CAS 1704082-21-2) is a chemical compound with the molecular formula C10H13BFNO3 and a molecular weight of 225.03 g/mol. IUPAC name: [3-fluoro-5-(propan-2-ylcarbamoyl)phenyl]boronic acid. InChIKey: PSHDRBRWPWFWKK-UHFFFAOYSA-N.
| Molecular formula | C10H13BFNO3 |
|---|---|
| Molecular weight | 225.03 g/mol |
| IUPAC name | [3-fluoro-5-(propan-2-ylcarbamoyl)phenyl]boronic acid |
| InChIKey | PSHDRBRWPWFWKK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)C(=O)NC(C)C)(O)O |
Computed by PubChem (NCBI)