Products 279262-09-8
CAS 279262-09-8 appears in our catalog under these names: 3-Fluoro-4-morpholinophenylboronic acid, 97%, 3–Fluoro–4–morpholinophenylboronic Acid, 3-Fluoro-4-morpholinophenylboronic Acid 95%, (3-Fluoro-4-morpholinophenyl)boronic acid, 95%, 95%, (3-Fluoro-4-morpholinophenyl)boronic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
(3-fluoro-4-morpholin-4-ylphenyl)boronic acid (CAS 279262-09-8) is a chemical compound with the molecular formula C10H13BFNO3 and a molecular weight of 225.03 g/mol. IUPAC name: (3-fluoro-4-morpholin-4-ylphenyl)boronic acid. InChIKey: JCGKJBDGVMLWBG-UHFFFAOYSA-N.
| Molecular formula | C10H13BFNO3 |
|---|---|
| Molecular weight | 225.03 g/mol |
| IUPAC name | (3-fluoro-4-morpholin-4-ylphenyl)boronic acid |
| InChIKey | JCGKJBDGVMLWBG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)N2CCOCC2)F)(O)O |
Computed by PubChem (NCBI)