CAS 874289-48-2 appears in our catalog under these names: (2-Fluoro-5-(propylcarbamoyl)phenyl)boronic acid 98%, (2-Fluoro-5-(propylcarbamoyl)phenyl)boronic acid, 98%, N-Propyl 3-borono-4-fluorobenzamide, 97%, N-Propyl 3-borono-4-fluorobenzamide, 98%, 98%. Offered by: Ambeed, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g.
[2-fluoro-5-(propylcarbamoyl)phenyl]boronic acid (CAS 874289-48-2) is a chemical compound with the molecular formula C10H13BFNO3 and a molecular weight of 225.03 g/mol. IUPAC name: [2-fluoro-5-(propylcarbamoyl)phenyl]boronic acid. InChIKey: UTFWGDUSGXDUNF-UHFFFAOYSA-N.
| Molecular formula | C10H13BFNO3 |
|---|---|
| Molecular weight | 225.03 g/mol |
| IUPAC name | [2-fluoro-5-(propylcarbamoyl)phenyl]boronic acid |
| InChIKey | UTFWGDUSGXDUNF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)NCCC)F)(O)O |
Computed by PubChem (NCBI)