CAS 1217500-95-2 appears in our catalog under these names: (3-Fluoro-5-morpholinophenyl)boronic acid, ≥95%, (3–Fluoro–5–morpholinophenyl)boronic acid, (3-Fluoro-5-morpholinophenyl)boronic acid, 96%, 96%. Offered by: Fluorochem, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 500mg, 100mg.
(3-fluoro-5-morpholin-4-ylphenyl)boronic acid (CAS 1217500-95-2) is a chemical compound with the molecular formula C10H13BFNO3 and a molecular weight of 225.03 g/mol. IUPAC name: (3-fluoro-5-morpholin-4-ylphenyl)boronic acid. InChIKey: LZZMZSFQBPERPZ-UHFFFAOYSA-N.
| Molecular formula | C10H13BFNO3 |
|---|---|
| Molecular weight | 225.03 g/mol |
| IUPAC name | (3-fluoro-5-morpholin-4-ylphenyl)boronic acid |
| InChIKey | LZZMZSFQBPERPZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)