cas: 66134-67-6 — see every product listed under this CAS number, including other names
N-Succinimidyl 4-Fluorobenzoate, >98.0%(HPLC)(N) (CAS 66134-67-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | S0985-1G |
| cas | 66134-67-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 536.31 Pln | |
| TCI | 5g | 1770.54 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(N) |
(2,5-dioxopyrrolidin-1-yl) 4-fluorobenzoate (CAS 66134-67-6) is a chemical compound with the molecular formula C11H8FNO4 and a molecular weight of 237.18 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-fluorobenzoate. InChIKey: LSSQMISUDUUZCC-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO4 |
|---|---|
| Molecular weight | 237.18 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-fluorobenzoate |
| InChIKey | LSSQMISUDUUZCC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)