cas: 66134-67-6 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 4-fluorobenzoate, 97% (CAS 66134-67-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228852-1G |
| cas | 66134-67-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 1070.47 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 4-fluorobenzoate (CAS 66134-67-6) is a chemical compound with the molecular formula C11H8FNO4 and a molecular weight of 237.18 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-fluorobenzoate. InChIKey: LSSQMISUDUUZCC-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO4 |
|---|---|
| Molecular weight | 237.18 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-fluorobenzoate |
| InChIKey | LSSQMISUDUUZCC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)