cas: 2350-01-8 — see every product listed under this CAS number, including other names
N-p-Aminophenyl-diphenylamine, 97% (CAS 2350-01-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036674-100MG |
| cas | 2350-01-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 737.26 Pln | |
| Fluorochem | 10g | 1190.22 Pln | |
| Fluorochem | 25g | 2320.03 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-N,4-N-diphenylbenzene-1,4-diamine (CAS 2350-01-8) is a chemical compound with the molecular formula C18H16N2 and a molecular weight of 260.3 g/mol. IUPAC name: 4-N,4-N-diphenylbenzene-1,4-diamine. InChIKey: UXKQNCDDHDBAPD-UHFFFAOYSA-N.
| Molecular formula | C18H16N2 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 4-N,4-N-diphenylbenzene-1,4-diamine |
| InChIKey | UXKQNCDDHDBAPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)