cas: 2350-01-8 — see every product listed under this CAS number, including other names
N1,N1-Diphenylbenzene-1,4-diamine, 97%, 97% (CAS 2350-01-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113NER-100mg |
| cas | 2350-01-8 |
| size | 100mg |
| availability | 275g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 597.20 Pln | |
| Chemat | 10g | 947.60 Pln | |
| Chemat | 25g | 1835.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-N,4-N-diphenylbenzene-1,4-diamine (CAS 2350-01-8) is a chemical compound with the molecular formula C18H16N2 and a molecular weight of 260.3 g/mol. IUPAC name: 4-N,4-N-diphenylbenzene-1,4-diamine. InChIKey: UXKQNCDDHDBAPD-UHFFFAOYSA-N.
| Molecular formula | C18H16N2 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 4-N,4-N-diphenylbenzene-1,4-diamine |
| InChIKey | UXKQNCDDHDBAPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)