CAS 2350-01-8 appears in our catalog under these names: 1-N,1-N-diphenylbenzene-1,4-diamine, 97%, 4-Aminotriphenylamine, >95.0%(HPLC)(T), N1,N1-Diphenylbenzene-1,4-diamine, 97%, 97%. Offered by: Combi-blocks, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg, 200mg, 100mg, 10g, 25g.
4-N,4-N-diphenylbenzene-1,4-diamine (CAS 2350-01-8) is a chemical compound with the molecular formula C18H16N2 and a molecular weight of 260.3 g/mol. IUPAC name: 4-N,4-N-diphenylbenzene-1,4-diamine. InChIKey: UXKQNCDDHDBAPD-UHFFFAOYSA-N.
| Molecular formula | C18H16N2 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 4-N,4-N-diphenylbenzene-1,4-diamine |
| InChIKey | UXKQNCDDHDBAPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)