CAS 790279-01-5 is the registry number for 2,2'-(4,6-Dimethyl-1,3-phenylene)dipyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-dimethyl-5-pyridin-2-ylphenyl)pyridine (CAS 790279-01-5) is a chemical compound with the molecular formula C18H16N2 and a molecular weight of 260.3 g/mol. IUPAC name: 2-(2,4-dimethyl-5-pyridin-2-ylphenyl)pyridine. InChIKey: AXEGSERXSTUNSX-UHFFFAOYSA-N.
| Molecular formula | C18H16N2 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 2-(2,4-dimethyl-5-pyridin-2-ylphenyl)pyridine |
| InChIKey | AXEGSERXSTUNSX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C2=CC=CC=N2)C3=CC=CC=N3)C |
Computed by PubChem (NCBI)