Products 878259-93-9

CAS 878259-93-9 is the registry number for N-Methyl-n'-(naphthalen-2-yl)benzenecarboximidamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

N'-methyl-N-naphthalen-2-ylbenzenecarboximidamide (CAS 878259-93-9) is a chemical compound with the molecular formula C18H16N2 and a molecular weight of 260.3 g/mol. IUPAC name: N'-methyl-N-naphthalen-2-ylbenzenecarboximidamide. InChIKey: TUSJQWBTBXCNFY-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16N2
Molecular weight260.3 g/mol
IUPAC nameN'-methyl-N-naphthalen-2-ylbenzenecarboximidamide
InChIKeyTUSJQWBTBXCNFY-UHFFFAOYSA-N
SMILESCN=C(C1=CC=CC=C1)NC2=CC3=CC=CC=C3C=C2

Computed by PubChem (NCBI)