CAS 55154-48-8 appears in our catalog under these names: N-phenylacetyl-L-Homoserine lactone/ 98.99% (existing batch purity), N–phenylacetyl–L–Homoserine lactone, (S)-N-(2-Oxotetrahydrofuran-3-yl)-2-phenylacetamide, 98.0%, 98.0%, N-Phenylacetyl-L-homoserine lactone, 99.60%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg.
N-[(3S)-2-oxooxolan-3-yl]-2-phenylacetamide (CAS 55154-48-8) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: N-[(3S)-2-oxooxolan-3-yl]-2-phenylacetamide. InChIKey: YJTHUPUWKQRCLF-JTQLQIEISA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | N-[(3S)-2-oxooxolan-3-yl]-2-phenylacetamide |
| InChIKey | YJTHUPUWKQRCLF-JTQLQIEISA-N |
| SMILES | C1COC(=O)[C@H]1NC(=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)