cas: 30924-93-7 — see every product listed under this CAS number, including other names
N-tert-Butoxycarbonyl-L-glutamic acid benzyl ester, 98%, 98% (CAS 30924-93-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1142NQ-1g |
| cas | 30924-93-7 |
| size | 1g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 179.60 Pln | |
| Chemat | 50g | 304.40 Pln | |
| Chemat | 100g | 539.60 Pln | |
| Chemat | 500g | 2251.20 Pln | |
| Chemat | 5kg | 15600.00 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid (CAS 30924-93-7) is a chemical compound with the molecular formula C17H23NO6 and a molecular weight of 337.4 g/mol. IUPAC name: (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: CVZUKWBYQQYBTF-ZDUSSCGKSA-N.
| Molecular formula | C17H23NO6 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | CVZUKWBYQQYBTF-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)O)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)