cas: 2766-43-0 — see every product listed under this CAS number, including other names
N-tert-Butoxycarbonyl-L-serine methyl ester, 98%, 98% (CAS 2766-43-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113UDG-1g |
| cas | 2766-43-0 |
| size | 1g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 50g | 107.60 Pln | |
| Chemat | 100g | 150.80 Pln | |
| Chemat | 250g | 270.80 Pln | |
| Chemat | 500g | 528.00 Pln | |
| Chemat | 1kg | 971.60 Pln | |
| Chemat | 5kg | 3638.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 2766-43-0) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: methyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: SANNKFASHWONFD-LURJTMIESA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | methyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | SANNKFASHWONFD-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C(=O)OC |
Computed by PubChem (NCBI)