CAS 69942-12-7 appears in our catalog under these names: N-((1,1-Dimethylethoxy)carbonyl)serine Methyl Ester, N–BOC–DL–serine methyl ester, Boc-DL-Ser-OMe 97%, Methyl 2-((tert-butoxycarbonyl)amino)-3-hydroxypropanoate, 97%, 97%, N-BOC-DL-serine methyl ester, 98.0%. Offered by: TRC, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 10g, 25g, 100g, 500g, 50g, 250g.
Methyl 3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 69942-12-7) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: methyl 3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: SANNKFASHWONFD-UHFFFAOYSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | methyl 3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | SANNKFASHWONFD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)C(=O)OC |
Computed by PubChem (NCBI)