CAS 95715-85-8 appears in our catalog under these names: N-tert-Butoxycarbonyl-D-Serine Methyl Ester, Boc–D–Ser–OMe, N-Boc-D-serine methyl ester, 97% , N-(tert-Butoxycarbonyl)-D-serine Methyl Ester, >98.0%(HPLC)(N), N-tert-Butoxycarbonyl D-serine methyl ester. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 100g, 25g, 5g, 1g, 50g, 10g, 250g, 500g.
Methyl (2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 95715-85-8) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: methyl (2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: SANNKFASHWONFD-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | methyl (2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | SANNKFASHWONFD-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)C(=O)OC |
Computed by PubChem (NCBI)