CAS 2766-43-0 appears in our catalog under these names: Boc–Ser–OMe, Boc-L-Ser-OMe, N-Boc-L-serine methyl ester, 95% , N-(tert-Butoxycarbonyl)-L-serine methyl ester, N-(tert-Butoxycarbonyl)-L-serine Methyl Ester, >95.0%(HPLC)(N). Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 100g, 500g, 25g, 2g, 10g, 0,1kg, 0,25kg, 5g.
Methyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 2766-43-0) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: methyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: SANNKFASHWONFD-LURJTMIESA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | methyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | SANNKFASHWONFD-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C(=O)OC |
Computed by PubChem (NCBI)