CAS 5096-84-4 appears in our catalog under these names: N2,N2-Dimethyl-5-nitropyrimidine-2,4-diamine, N2,N2-Dimethyl-5-Nitropyrimidine-2,4-Diamine, 98%, 98%, N2,N2-Dimethyl-5-nitropyrimidine-2,4-diamine, 98%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g.
2-N,2-N-dimethyl-5-nitropyrimidine-2,4-diamine (CAS 5096-84-4) is a chemical compound with the molecular formula C6H9N5O2 and a molecular weight of 183.17 g/mol. IUPAC name: 2-N,2-N-dimethyl-5-nitropyrimidine-2,4-diamine. InChIKey: CBIXYNSEBOBXRD-UHFFFAOYSA-N.
| Molecular formula | C6H9N5O2 |
|---|---|
| Molecular weight | 183.17 g/mol |
| IUPAC name | 2-N,2-N-dimethyl-5-nitropyrimidine-2,4-diamine |
| InChIKey | CBIXYNSEBOBXRD-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC=C(C(=N1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)