CAS 2946-89-6 is the registry number for 3,5-DIMETHYL-N-NITRO-1H-PYRAZOLE-1-CARBOXIMIDAMIDE, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,5-dimethyl-N-nitropyrazole-1-carboximidamide (CAS 2946-89-6) is a chemical compound with the molecular formula C6H9N5O2 and a molecular weight of 183.17 g/mol. IUPAC name: 3,5-dimethyl-N-nitropyrazole-1-carboximidamide. InChIKey: YJQYMUPERFRTJO-UHFFFAOYSA-N.
| Molecular formula | C6H9N5O2 |
|---|---|
| Molecular weight | 183.17 g/mol |
| IUPAC name | 3,5-dimethyl-N-nitropyrazole-1-carboximidamide |
| InChIKey | YJQYMUPERFRTJO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C(=N)N[N+](=O)[O-])C |
Computed by PubChem (NCBI)