CAS 1379173-03-1 appears in our catalog under these names: 4-Amino-6-(dimethylamino)-1,3,5-triazine-2-carboxylic acid, 95%, 4-Amino-6-(dimethylamino)-1,3,5-triazine-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-amino-6-(dimethylamino)-1,3,5-triazine-2-carboxylic acid (CAS 1379173-03-1) is a chemical compound with the molecular formula C6H9N5O2 and a molecular weight of 183.17 g/mol. IUPAC name: 4-amino-6-(dimethylamino)-1,3,5-triazine-2-carboxylic acid. InChIKey: LSQOAPGHUOLVNK-UHFFFAOYSA-N.
| Molecular formula | C6H9N5O2 |
|---|---|
| Molecular weight | 183.17 g/mol |
| IUPAC name | 4-amino-6-(dimethylamino)-1,3,5-triazine-2-carboxylic acid |
| InChIKey | LSQOAPGHUOLVNK-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=NC(=N1)N)C(=O)O |
Computed by PubChem (NCBI)