Products 1340357-95-0
CAS 1340357-95-0 is the registry number for 1-(1-Methyl-1H-1,2,3,4-tetrazol-5-yl)azetidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(1-methyltetrazol-5-yl)azetidine-3-carboxylic acid (CAS 1340357-95-0) is a chemical compound with the molecular formula C6H9N5O2 and a molecular weight of 183.17 g/mol. IUPAC name: 1-(1-methyltetrazol-5-yl)azetidine-3-carboxylic acid. InChIKey: LYSASALARDKFIC-UHFFFAOYSA-N.
| Molecular formula | C6H9N5O2 |
|---|---|
| Molecular weight | 183.17 g/mol |
| IUPAC name | 1-(1-methyltetrazol-5-yl)azetidine-3-carboxylic acid |
| InChIKey | LYSASALARDKFIC-UHFFFAOYSA-N |
| SMILES | CN1C(=NN=N1)N2CC(C2)C(=O)O |
Computed by PubChem (NCBI)