CAS 6964-30-3 is the registry number for N4,N6-Dimethyl-5-nitropyrimidine-4,6-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-N,6-N-dimethyl-5-nitropyrimidine-4,6-diamine (CAS 6964-30-3) is a chemical compound with the molecular formula C6H9N5O2 and a molecular weight of 183.17 g/mol. IUPAC name: 4-N,6-N-dimethyl-5-nitropyrimidine-4,6-diamine. InChIKey: UXSRDBONEIZHCE-UHFFFAOYSA-N.
| Molecular formula | C6H9N5O2 |
|---|---|
| Molecular weight | 183.17 g/mol |
| IUPAC name | 4-N,6-N-dimethyl-5-nitropyrimidine-4,6-diamine |
| InChIKey | UXSRDBONEIZHCE-UHFFFAOYSA-N |
| SMILES | CNC1=C(C(=NC=N1)NC)[N+](=O)[O-] |
Computed by PubChem (NCBI)