cas: 142847-17-4 — see every product listed under this CAS number, including other names
N2-[(1,1-Dimethylethoxy)carbonyl]asparagine, 97%, 97% (CAS 142847-17-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110AW3-1g |
| cas | 142847-17-4 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 25g | 851.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 142847-17-4) is a chemical compound with the molecular formula C9H16N2O5 and a molecular weight of 232.23 g/mol. IUPAC name: 4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: FYYSQDHBALBGHX-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O5 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | FYYSQDHBALBGHX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)